C17H24N2O2 — CID 116521754
7-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 116521754) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 7-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 7-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 116521754 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 7-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CC1(C)CCC(CN2C(=O)CCCc3cc(N)ccc32)O1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2)9-8-14(21-17)11-19-15-7-6-13(18)10-12(15)4-3-5-16(19)20/h6-7,10,14H,3-5,8-9,11,18H2,1-2H3 |
| InChIKey | VGORAWFRMDPNOQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|