C16H21NO3 — CID 116521824
4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-ethoxybenzonitrile (PubChem CID 116521824) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-ethoxybenzonitrile.
| Compound Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-ethoxybenzonitrile |
|---|---|
| PubChem CID | 116521824 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C16H21NO3/c1-4-18-15-9-12(10-17)5-6-14(15)19-11-13-7-8-16(2,3)20-13/h5-6,9,13H,4,7-8,11H2,1-3H3 |
| InChIKey | VNHMQAGLDWVOSP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |