C16H21NO3 — CID 65213657
3-ethoxy-4-[(1-hydroxycyclohexyl)methoxy]benzonitrile (PubChem CID 65213657) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-ethoxy-4-[(1-hydroxycyclohexyl)methoxy]benzonitrile.
| Compound Name | 3-ethoxy-4-[(1-hydroxycyclohexyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 65213657 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-ethoxy-4-[(1-hydroxycyclohexyl)methoxy]benzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCC1(O)CCCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-2-19-15-10-13(11-17)6-7-14(15)20-12-16(18)8-4-3-5-9-16/h6-7,10,18H,2-5,8-9,12H2,1H3 |
| InChIKey | BSXOTAGDROUUDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |