C12H25N3O — CID 116522034
3-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanimidamide (PubChem CID 116522034) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanimidamide.
| Compound Name | 3-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanimidamide |
|---|---|
| PubChem CID | 116522034 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3-[(5,5-dimethyloxolan-2-yl)methyl-methylamino]butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)N(C)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H25N3O/c1-9(7-11(13)14)15(4)8-10-5-6-12(2,3)16-10/h9-10H,5-8H2,1-4H3,(H3,13,14) |
| InChIKey | ZGIMLMYOHLADCS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|