C15H27ClO — CID 116523345
5-[(2-chloro-5-ethylcyclohexyl)methyl]-2,2-dimethyloxolane (PubChem CID 116523345) has the molecular formula C15H27ClO and a molecular weight of 258.83 g/mol. Its IUPAC name is 5-[(2-chloro-5-ethylcyclohexyl)methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[(2-chloro-5-ethylcyclohexyl)methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116523345 |
| Molecular Formula | C15H27ClO |
| Molecular Weight | 258.83 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 5-[(2-chloro-5-ethylcyclohexyl)methyl]-2,2-dimethyloxolane |
| SMILES | CCC1CCC(Cl)C(CC2CCC(C)(C)O2)C1 |
| InChI | InChI=1S/C15H27ClO/c1-4-11-5-6-14(16)12(9-11)10-13-7-8-15(2,3)17-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | WHLRPOLUNYIWAN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|