C10H19Cl — CID 58445540
(2R)-2-chloro-1,4-diethylcyclohexane (PubChem CID 58445540) has the molecular formula C10H19Cl and a molecular weight of 174.71 g/mol. Its IUPAC name is (2R)-2-chloro-1,4-diethylcyclohexane.
| Compound Name | (2R)-2-chloro-1,4-diethylcyclohexane |
|---|---|
| PubChem CID | 58445540 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (2R)-2-chloro-1,4-diethylcyclohexane |
| SMILES | CCC1CCC(CC)[C@H](Cl)C1 |
| InChI | InChI=1S/C10H19Cl/c1-3-8-5-6-9(4-2)10(11)7-8/h8-10H,3-7H2,1-2H3/t8?,9?,10-/m1/s1 |
| InChIKey | UVDJGQBOKPXKSY-UDNWOFFPSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|