C11H21ClO2 — CID 116523365
5-(3-chloro-4-methoxybutyl)-2,2-dimethyloxolane (PubChem CID 116523365) has the molecular formula C11H21ClO2 and a molecular weight of 220.74 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxybutyl)-2,2-dimethyloxolane.
| Compound Name | 5-(3-chloro-4-methoxybutyl)-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116523365 |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 5-(3-chloro-4-methoxybutyl)-2,2-dimethyloxolane |
| SMILES | COCC(Cl)CCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C11H21ClO2/c1-11(2)7-6-10(14-11)5-4-9(12)8-13-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | SRLYWZQLWBNCBN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|