About 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane
5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane (PubChem CID 116523355) has the molecular formula C12H23BrO
and a molecular weight of 263.22 g/mol. Its IUPAC name is 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane |
| PubChem CID | 116523355 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane |
| SMILES | CC(C)C(Br)CCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H23BrO/c1-9(2)11(13)6-5-10-7-8-12(3,4)14-10/h9-11H,5-8H2,1-4H3 |
| InChIKey | GKRZAIZIQYYFBC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane?
The IUPAC name of 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane (CID 116523355) is 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane.
What is the SMILES notation for 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane?
The canonical SMILES for 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane is CC(C)C(Br)CCC1CCC(C)(C)O1.
What is the InChIKey of 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane?
The InChIKey is GKRZAIZIQYYFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO/c1-9(2)11(13)6-5-10-7-8-12(3,4)14-10/h9-11H,5-8H2,1-4H3.
What are the key properties of 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane?
5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane has a molecular weight of 263.22 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane is sourced from PubChem (CID 116523355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).