C12H23BrO — CID 116523355
5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane (PubChem CID 116523355) has the molecular formula C12H23BrO and a molecular weight of 263.22 g/mol. Its IUPAC name is 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane.
| Compound Name | 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116523355 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-(3-bromo-4-methylpentyl)-2,2-dimethyloxolane |
| SMILES | CC(C)C(Br)CCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H23BrO/c1-9(2)11(13)6-5-10-7-8-12(3,4)14-10/h9-11H,5-8H2,1-4H3 |
| InChIKey | GKRZAIZIQYYFBC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|