C14H29NO — CID 116524272
6-(5,5-dimethyloxolan-2-yl)-2,2-dimethylhexan-3-amine (PubChem CID 116524272) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 6-(5,5-dimethyloxolan-2-yl)-2,2-dimethylhexan-3-amine.
| Compound Name | 6-(5,5-dimethyloxolan-2-yl)-2,2-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 116524272 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 6-(5,5-dimethyloxolan-2-yl)-2,2-dimethylhexan-3-amine |
| SMILES | CC1(C)CCC(CCCC(N)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H29NO/c1-13(2,3)12(15)8-6-7-11-9-10-14(4,5)16-11/h11-12H,6-10,15H2,1-5H3 |
| InChIKey | WLDPMOHBWDUWGU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |