C10H20O2 — CID 116524331
4-(5,5-dimethyloxolan-2-yl)butan-1-ol (PubChem CID 116524331) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-(5,5-dimethyloxolan-2-yl)butan-1-ol.
| Compound Name | 4-(5,5-dimethyloxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 116524331 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 4-(5,5-dimethyloxolan-2-yl)butan-1-ol |
| SMILES | CC1(C)CCC(CCCCO)O1 |
| InChI | InChI=1S/C10H20O2/c1-10(2)7-6-9(12-10)5-3-4-8-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | ICDPXHBZYVFIBP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|