C11H19BrOS — CID 116523377
5-[(4-bromothiolan-3-yl)methyl]-2,2-dimethyloxolane (PubChem CID 116523377) has the molecular formula C11H19BrOS and a molecular weight of 279.24 g/mol. Its IUPAC name is 5-[(4-bromothiolan-3-yl)methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[(4-bromothiolan-3-yl)methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116523377 |
| Molecular Formula | C11H19BrOS |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 5-[(4-bromothiolan-3-yl)methyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(CC2CSCC2Br)O1 |
| InChI | InChI=1S/C11H19BrOS/c1-11(2)4-3-9(13-11)5-8-6-14-7-10(8)12/h8-10H,3-7H2,1-2H3 |
| InChIKey | RFYBYHRWEHNWIV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|