C14H23BrO — CID 116525254
5-[[3-(bromomethyl)-3-bicyclo[3.1.0]hexanyl]methyl]-2,2-dimethyloxolane (PubChem CID 116525254) has the molecular formula C14H23BrO and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-[[3-(bromomethyl)-3-bicyclo[3.1.0]hexanyl]methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[[3-(bromomethyl)-3-bicyclo[3.1.0]hexanyl]methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525254 |
| Molecular Formula | C14H23BrO |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-[[3-(bromomethyl)-3-bicyclo[3.1.0]hexanyl]methyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(CC2(CBr)CC3CC3C2)O1 |
| InChI | InChI=1S/C14H23BrO/c1-13(2)4-3-12(16-13)8-14(9-15)6-10-5-11(10)7-14/h10-12H,3-9H2,1-2H3 |
| InChIKey | PVTPKCGBXAOAEK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|