C20H16N2O2 — CID 11652603
ethyl 2-phenyl-9H-pyrido[2,3-b]indole-5-carboxylate (PubChem CID 11652603) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 2-phenyl-9H-pyrido[2,3-b]indole-5-carboxylate.
| Compound Name | ethyl 2-phenyl-9H-pyrido[2,3-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 11652603 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 2-phenyl-9H-pyrido[2,3-b]indole-5-carboxylate |
| SMILES | CCOC(=O)c1cccc2[nH]c3nc(-c4ccccc4)ccc3c12 |
| InChI | InChI=1S/C20H16N2O2/c1-2-24-20(23)15-9-6-10-17-18(15)14-11-12-16(21-19(14)22-17)13-7-4-3-5-8-13/h3-12H,2H2,1H3,(H,21,22) |
| InChIKey | SZJDBCBOFLVTLV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |