C13H18BrFN2O2S — CID 116527979
4-bromo-2-fluoro-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide (PubChem CID 116527979) has the molecular formula C13H18BrFN2O2S and a molecular weight of 365.27 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 116527979 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-bromo-2-fluoro-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2ccc(Br)cc2F)CCCNC1 |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-13(5-2-6-16-8-13)9-17-20(18,19)12-4-3-10(14)7-11(12)15/h3-4,7,16-17H,2,5-6,8-9H2,1H3 |
| InChIKey | UFIYANPCWVLFJT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |