C13H14BrFN2O3S — CID 116529898
5-amino-4-bromo-N-ethyl-2-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 116529898) has the molecular formula C13H14BrFN2O3S and a molecular weight of 377.24 g/mol. Its IUPAC name is 5-amino-4-bromo-N-ethyl-2-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-ethyl-2-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529898 |
| Molecular Formula | C13H14BrFN2O3S |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 5-amino-4-bromo-N-ethyl-2-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | CCN(Cc1ccco1)S(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C13H14BrFN2O3S/c1-2-17(8-9-4-3-5-20-9)21(18,19)13-7-12(16)10(14)6-11(13)15/h3-7H,2,8,16H2,1H3 |
| InChIKey | NRQBMVOWSUOKMB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|