C12H14BrFN2O2S — CID 116529864
5-amino-4-bromo-2-fluoro-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 116529864) has the molecular formula C12H14BrFN2O2S and a molecular weight of 349.23 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529864 |
| Molecular Formula | C12H14BrFN2O2S |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C12H14BrFN2O2S/c1-3-5-16(6-4-2)19(17,18)12-8-11(15)9(13)7-10(12)14/h3-4,7-8H,1-2,5-6,15H2 |
| InChIKey | GKVXLVJQJCDUFW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|