C11H10FNO3 — CID 116531327
5-fluoro-1-formamido-2,3-dihydroindene-1-carboxylic acid (PubChem CID 116531327) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 5-fluoro-1-formamido-2,3-dihydroindene-1-carboxylic acid.
| Compound Name | 5-fluoro-1-formamido-2,3-dihydroindene-1-carboxylic acid |
|---|---|
| PubChem CID | 116531327 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-fluoro-1-formamido-2,3-dihydroindene-1-carboxylic acid |
| SMILES | O=CNC1(C(=O)O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C11H10FNO3/c12-8-1-2-9-7(5-8)3-4-11(9,10(15)16)13-6-14/h1-2,5-6H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | QEZZULZXYVNVJE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|