C15H17FN2OS — CID 116531560
5-fluoro-N-(2-methoxyethyl)-1-(1,3-thiazol-2-yl)-2,3-dihydroinden-1-amine (PubChem CID 116531560) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-fluoro-N-(2-methoxyethyl)-1-(1,3-thiazol-2-yl)-2,3-dihydroinden-1-amine.
| Compound Name | 5-fluoro-N-(2-methoxyethyl)-1-(1,3-thiazol-2-yl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 116531560 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-fluoro-N-(2-methoxyethyl)-1-(1,3-thiazol-2-yl)-2,3-dihydroinden-1-amine |
| SMILES | COCCNC1(c2nccs2)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H17FN2OS/c1-19-8-6-18-15(14-17-7-9-20-14)5-4-11-10-12(16)2-3-13(11)15/h2-3,7,9-10,18H,4-6,8H2,1H3 |
| InChIKey | HEIYLLFUOTZZGJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|