C13H16BrF — CID 116532446
1-(1-bromo-2-methylpropyl)-5-fluoro-2,3-dihydro-1H-indene (PubChem CID 116532446) has the molecular formula C13H16BrF and a molecular weight of 271.17 g/mol. Its IUPAC name is 1-(1-bromo-2-methylpropyl)-5-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 1-(1-bromo-2-methylpropyl)-5-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 116532446 |
| Molecular Formula | C13H16BrF |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-(1-bromo-2-methylpropyl)-5-fluoro-2,3-dihydro-1H-indene |
| SMILES | CC(C)C(Br)C1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C13H16BrF/c1-8(2)13(14)12-5-3-9-7-10(15)4-6-11(9)12/h4,6-8,12-13H,3,5H2,1-2H3 |
| InChIKey | XIENBMWGBYJKPY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|