C15H17F3N2 — CID 116534270
N-(6,6,6-trifluorohexan-2-yl)isoquinolin-5-amine (PubChem CID 116534270) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-(6,6,6-trifluorohexan-2-yl)isoquinolin-5-amine.
| Compound Name | N-(6,6,6-trifluorohexan-2-yl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 116534270 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-(6,6,6-trifluorohexan-2-yl)isoquinolin-5-amine |
| SMILES | CC(CCCC(F)(F)F)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C15H17F3N2/c1-11(4-3-8-15(16,17)18)20-14-6-2-5-12-10-19-9-7-13(12)14/h2,5-7,9-11,20H,3-4,8H2,1H3 |
| InChIKey | VNICUTVBESVBMA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |