C10H16F3N3 — CID 116534621
6,6,6-trifluoro-N-(1H-pyrazol-4-ylmethyl)hexan-2-amine (PubChem CID 116534621) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is 6,6,6-trifluoro-N-(1H-pyrazol-4-ylmethyl)hexan-2-amine.
| Compound Name | 6,6,6-trifluoro-N-(1H-pyrazol-4-ylmethyl)hexan-2-amine |
|---|---|
| PubChem CID | 116534621 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6,6,6-trifluoro-N-(1H-pyrazol-4-ylmethyl)hexan-2-amine |
| SMILES | CC(CCCC(F)(F)F)NCc1cn[nH]c1 |
| InChI | InChI=1S/C10H16F3N3/c1-8(3-2-4-10(11,12)13)14-5-9-6-15-16-7-9/h6-8,14H,2-5H2,1H3,(H,15,16) |
| InChIKey | MYAQHDHFCPWANJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |