C11H20F3NO — CID 116534784
1-cyclopropyl-2-(6,6,6-trifluorohexan-2-ylamino)ethanol (PubChem CID 116534784) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-cyclopropyl-2-(6,6,6-trifluorohexan-2-ylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(6,6,6-trifluorohexan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 116534784 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-cyclopropyl-2-(6,6,6-trifluorohexan-2-ylamino)ethanol |
| SMILES | CC(CCCC(F)(F)F)NCC(O)C1CC1 |
| InChI | InChI=1S/C11H20F3NO/c1-8(3-2-6-11(12,13)14)15-7-10(16)9-4-5-9/h8-10,15-16H,2-7H2,1H3 |
| InChIKey | LBYLBRRAKXYNOK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |