C14H25F3O — CID 113326892
5,5,5-trifluoro-1-(4-propan-2-ylcyclohexyl)pentan-1-ol (PubChem CID 113326892) has the molecular formula C14H25F3O and a molecular weight of 266.35 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(4-propan-2-ylcyclohexyl)pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-(4-propan-2-ylcyclohexyl)pentan-1-ol |
|---|---|
| PubChem CID | 113326892 |
| Molecular Formula | C14H25F3O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 5,5,5-trifluoro-1-(4-propan-2-ylcyclohexyl)pentan-1-ol |
| SMILES | CC(C)C1CCC(C(O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3O/c1-10(2)11-5-7-12(8-6-11)13(18)4-3-9-14(15,16)17/h10-13,18H,3-9H2,1-2H3 |
| InChIKey | AGNMUHXAYBDSHE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |