C15H28F3N3 — CID 116535380
6,6,6-trifluoro-2-methyl-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-amine (PubChem CID 116535380) has the molecular formula C15H28F3N3 and a molecular weight of 307.40 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-amine.
| Compound Name | 6,6,6-trifluoro-2-methyl-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 116535380 |
| Molecular Formula | C15H28F3N3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-amine |
| SMILES | CC1CN2CCCC2CN1C(C)(CN)CCCC(F)(F)F |
| InChI | InChI=1S/C15H28F3N3/c1-12-9-20-8-3-5-13(20)10-21(12)14(2,11-19)6-4-7-15(16,17)18/h12-13H,3-11,19H2,1-2H3 |
| InChIKey | BKGBVDGCAHPDOS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |