C25H23NO2 — CID 11653566
[(3R,5R)-3-anthracen-9-yl-2-benzyl-1,2-oxazolidin-5-yl]methanol (PubChem CID 11653566) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(3R,5R)-3-anthracen-9-yl-2-benzyl-1,2-oxazolidin-5-yl]methanol.
| Compound Name | [(3R,5R)-3-anthracen-9-yl-2-benzyl-1,2-oxazolidin-5-yl]methanol |
|---|---|
| PubChem CID | 11653566 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(3R,5R)-3-anthracen-9-yl-2-benzyl-1,2-oxazolidin-5-yl]methanol |
| SMILES | OC[C@H]1C[C@H](c2c3ccccc3cc3ccccc23)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H23NO2/c27-17-21-15-24(26(28-21)16-18-8-2-1-3-9-18)25-22-12-6-4-10-19(22)14-20-11-5-7-13-23(20)25/h1-14,21,24,27H,15-17H2/t21-,24-/m1/s1 |
| InChIKey | MSTYJZCYVYXJAT-ZJSXRUAMSA-N |
| XLogP | 5.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|