C13H21F3N2O — CID 116535799
6,6,6-trifluoro-2-methyl-1-(1-propylimidazol-2-yl)hexan-2-ol (PubChem CID 116535799) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-1-(1-propylimidazol-2-yl)hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-methyl-1-(1-propylimidazol-2-yl)hexan-2-ol |
|---|---|
| PubChem CID | 116535799 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-1-(1-propylimidazol-2-yl)hexan-2-ol |
| SMILES | CCCn1ccnc1CC(C)(O)CCCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-3-8-18-9-7-17-11(18)10-12(2,19)5-4-6-13(14,15)16/h7,9,19H,3-6,8,10H2,1-2H3 |
| InChIKey | XNFVOHKODNLNND-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |