About 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid
2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid (PubChem CID 116537054) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid |
| PubChem CID | 116537054 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C1CCN(C(=O)C(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO3/c1-15(2,3)11-7-9-17(10-8-11)13(18)12(14(19)20)16(4,5)6/h11-12H,7-10H2,1-6H3,(H,19,20) |
| InChIKey | ICWPFIOBZCRMDK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid (CID 116537054) is 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid is CC(C)(C)C1CCN(C(=O)C(C(=O)O)C(C)(C)C)CC1.
What is the InChIKey of 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid?
The InChIKey is ICWPFIOBZCRMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-15(2,3)11-7-9-17(10-8-11)13(18)12(14(19)20)16(4,5)6/h11-12H,7-10H2,1-6H3,(H,19,20).
What are the key properties of 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid?
2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid has a molecular weight of 283.41 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 116537054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).