C14H25NO3 — CID 116537076
2-(2,4-dimethylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid (PubChem CID 116537076) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(2,4-dimethylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(2,4-dimethylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116537076 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-(2,4-dimethylpiperidine-1-carbonyl)-3,3-dimethylbutanoic acid |
| SMILES | CC1CCN(C(=O)C(C(=O)O)C(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C14H25NO3/c1-9-6-7-15(10(2)8-9)12(16)11(13(17)18)14(3,4)5/h9-11H,6-8H2,1-5H3,(H,17,18) |
| InChIKey | HULIQHPXJWGQNK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|