C12H16ClN — CID 116540327
3-(3-chloro-1-methylcyclopentyl)-4-methylpyridine (PubChem CID 116540327) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 3-(3-chloro-1-methylcyclopentyl)-4-methylpyridine.
| Compound Name | 3-(3-chloro-1-methylcyclopentyl)-4-methylpyridine |
|---|---|
| PubChem CID | 116540327 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-(3-chloro-1-methylcyclopentyl)-4-methylpyridine |
| SMILES | Cc1ccncc1C1(C)CCC(Cl)C1 |
| InChI | InChI=1S/C12H16ClN/c1-9-4-6-14-8-11(9)12(2)5-3-10(13)7-12/h4,6,8,10H,3,5,7H2,1-2H3 |
| InChIKey | QOGNCKRAIIXSOZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|