C12H15BrN2S — CID 116540779
6-[(3-bromo-1-methylcyclopentyl)methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 116540779) has the molecular formula C12H15BrN2S and a molecular weight of 299.24 g/mol. Its IUPAC name is 6-[(3-bromo-1-methylcyclopentyl)methyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(3-bromo-1-methylcyclopentyl)methyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 116540779 |
| Molecular Formula | C12H15BrN2S |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 6-[(3-bromo-1-methylcyclopentyl)methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | CC1(Cc2cn3ccsc3n2)CCC(Br)C1 |
| InChI | InChI=1S/C12H15BrN2S/c1-12(3-2-9(13)6-12)7-10-8-15-4-5-16-11(15)14-10/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | ZQFZSOKYGJKHKO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|