C19H23N — CID 116542927
2-[3-(2-methylpropyl)phenyl]-1,3-dihydroinden-2-amine (PubChem CID 116542927) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)phenyl]-1,3-dihydroinden-2-amine.
| Compound Name | 2-[3-(2-methylpropyl)phenyl]-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 116542927 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-[3-(2-methylpropyl)phenyl]-1,3-dihydroinden-2-amine |
| SMILES | CC(C)Cc1cccc(C2(N)Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H23N/c1-14(2)10-15-6-5-9-18(11-15)19(20)12-16-7-3-4-8-17(16)13-19/h3-9,11,14H,10,12-13,20H2,1-2H3 |
| InChIKey | WKDXQBSJTQMULC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |