C18H16N4O5 — CID 11654329
N'-(2-amino-3-naphthalen-1-ylpropanoyl)-5-nitrofuran-2-carbohydrazide (PubChem CID 11654329) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is N'-(2-amino-3-naphthalen-1-ylpropanoyl)-5-nitrofuran-2-carbohydrazide.
| Compound Name | N'-(2-amino-3-naphthalen-1-ylpropanoyl)-5-nitrofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 11654329 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N'-(2-amino-3-naphthalen-1-ylpropanoyl)-5-nitrofuran-2-carbohydrazide |
| SMILES | NC(Cc1cccc2ccccc12)C(=O)NNC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H16N4O5/c19-14(10-12-6-3-5-11-4-1-2-7-13(11)12)17(23)20-21-18(24)15-8-9-16(27-15)22(25)26/h1-9,14H,10,19H2,(H,20,23)(H,21,24) |
| InChIKey | GOBHAQVCEXXABF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|