C18H17NS — CID 116546719
1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-6-methylindole (PubChem CID 116546719) has the molecular formula C18H17NS and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-6-methylindole.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-6-methylindole |
|---|---|
| PubChem CID | 116546719 |
| Molecular Formula | C18H17NS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-6-methylindole |
| SMILES | Cc1ccc2ccn(CC3Cc4ccccc4S3)c2c1 |
| InChI | InChI=1S/C18H17NS/c1-13-6-7-14-8-9-19(17(14)10-13)12-16-11-15-4-2-3-5-18(15)20-16/h2-10,16H,11-12H2,1H3 |
| InChIKey | NXGUJGHUHIREKV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |