C12H15F2NO3S — CID 116552117
3-amino-1-(2,3-difluorophenyl)-5-methylsulfonylpentan-2-one (PubChem CID 116552117) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 3-amino-1-(2,3-difluorophenyl)-5-methylsulfonylpentan-2-one.
| Compound Name | 3-amino-1-(2,3-difluorophenyl)-5-methylsulfonylpentan-2-one |
|---|---|
| PubChem CID | 116552117 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-amino-1-(2,3-difluorophenyl)-5-methylsulfonylpentan-2-one |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Cc1cccc(F)c1F |
| InChI | InChI=1S/C12H15F2NO3S/c1-19(17,18)6-5-10(15)11(16)7-8-3-2-4-9(13)12(8)14/h2-4,10H,5-7,15H2,1H3 |
| InChIKey | FNCLLAJFLQUENJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |