C13H19NO2 — CID 116552817
3-amino-1-(4-hydroxyphenyl)-4-methylhexan-2-one (PubChem CID 116552817) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-amino-1-(4-hydroxyphenyl)-4-methylhexan-2-one.
| Compound Name | 3-amino-1-(4-hydroxyphenyl)-4-methylhexan-2-one |
|---|---|
| PubChem CID | 116552817 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-amino-1-(4-hydroxyphenyl)-4-methylhexan-2-one |
| SMILES | CCC(C)C(N)C(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-3-9(2)13(14)12(16)8-10-4-6-11(15)7-5-10/h4-7,9,13,15H,3,8,14H2,1-2H3 |
| InChIKey | YZIFUZHMKYJGER-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |