C13H18ClNO2 — CID 65127089
(4-chlorophenyl)methyl (2S)-2-amino-3-methylpentanoate (PubChem CID 65127089) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (2S)-2-amino-3-methylpentanoate.
| Compound Name | (4-chlorophenyl)methyl (2S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 65127089 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (4-chlorophenyl)methyl (2S)-2-amino-3-methylpentanoate |
| SMILES | CCC(C)[C@H](N)C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-3-9(2)12(15)13(16)17-8-10-4-6-11(14)7-5-10/h4-7,9,12H,3,8,15H2,1-2H3/t9?,12-/m0/s1 |
| InChIKey | QAWYWXPOTMPZDE-ACGXKRRESA-N |
| XLogP | 2.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |