About (4-chlorophenyl)methyl 3-methylpentanoate
(4-chlorophenyl)methyl 3-methylpentanoate (PubChem CID 102077326) has the molecular formula C13H17ClO2
and a molecular weight of 240.73 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-methylpentanoate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 3-methylpentanoate |
| PubChem CID | 102077326 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (4-chlorophenyl)methyl 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClO2/c1-3-10(2)8-13(15)16-9-11-4-6-12(14)7-5-11/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | OIOBTUBNJLDRKU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methyl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 3-methylpentanoate?
The IUPAC name of (4-chlorophenyl)methyl 3-methylpentanoate (CID 102077326) is (4-chlorophenyl)methyl 3-methylpentanoate.
What is the SMILES notation for (4-chlorophenyl)methyl 3-methylpentanoate?
The canonical SMILES for (4-chlorophenyl)methyl 3-methylpentanoate is CCC(C)CC(=O)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 3-methylpentanoate?
The InChIKey is OIOBTUBNJLDRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO2/c1-3-10(2)8-13(15)16-9-11-4-6-12(14)7-5-11/h4-7,10H,3,8-9H2,1-2H3.
What are the key properties of (4-chlorophenyl)methyl 3-methylpentanoate?
(4-chlorophenyl)methyl 3-methylpentanoate has a molecular weight of 240.73 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 3-methylpentanoate is sourced from PubChem (CID 102077326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).