C24H35NO5S — CID 11655321
(4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 11655321) has the molecular formula C24H35NO5S and a molecular weight of 449.61 g/mol. Its IUPAC name is (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 11655321 |
| Molecular Formula | C24H35NO5S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (4S,7R,8S,9S,10Z,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-thiazol-4-yl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)/C=C\C1 |
| InChI | InChI=1S/C24H35NO5S/c1-14-8-7-9-15(2)22(28)16(3)23(29)24(5,6)20(26)12-21(27)30-19(11-10-14)18-13-31-17(4)25-18/h7,9-10,13,15-16,19-20,22,26,28H,8,11-12H2,1-6H3/b9-7-,14-10-/t15-,16+,19-,20-,22-/m0/s1 |
| InChIKey | RNTVCEJJINFVBY-ZRTNWGERSA-N |
| XLogP | 4.31 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|