C13H19NO3 — CID 116553831
1-(3,4-diethoxyphenyl)-2-(methylamino)ethanone (PubChem CID 116553831) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(3,4-diethoxyphenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 116553831 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-2-(methylamino)ethanone |
| SMILES | CCOc1ccc(C(=O)CNC)cc1OCC |
| InChI | InChI=1S/C13H19NO3/c1-4-16-12-7-6-10(11(15)9-14-3)8-13(12)17-5-2/h6-8,14H,4-5,9H2,1-3H3 |
| InChIKey | XYCQTZPXJFDUMC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |