C16H25NO3 — CID 116556276
2-(butan-2-ylamino)-1-(3,4-diethoxyphenyl)ethanone (PubChem CID 116556276) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-1-(3,4-diethoxyphenyl)ethanone.
| Compound Name | 2-(butan-2-ylamino)-1-(3,4-diethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 116556276 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-(butan-2-ylamino)-1-(3,4-diethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(C(=O)CNC(C)CC)cc1OCC |
| InChI | InChI=1S/C16H25NO3/c1-5-12(4)17-11-14(18)13-8-9-15(19-6-2)16(10-13)20-7-3/h8-10,12,17H,5-7,11H2,1-4H3 |
| InChIKey | HKJGOMADIKMWNN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |