C17H23NO — CID 116554085
2,3-dihydro-1H-indol-5-yl-(3-ethylcyclohexyl)methanone (PubChem CID 116554085) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-5-yl-(3-ethylcyclohexyl)methanone.
| Compound Name | 2,3-dihydro-1H-indol-5-yl-(3-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116554085 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2,3-dihydro-1H-indol-5-yl-(3-ethylcyclohexyl)methanone |
| SMILES | CCC1CCCC(C(=O)c2ccc3c(c2)CCN3)C1 |
| InChI | InChI=1S/C17H23NO/c1-2-12-4-3-5-14(10-12)17(19)15-6-7-16-13(11-15)8-9-18-16/h6-7,11-12,14,18H,2-5,8-10H2,1H3 |
| InChIKey | ATXRCAPAKAIISM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |