C14H20BrNO — CID 116558152
1-(2-bromophenyl)-5-(propan-2-ylamino)pentan-2-one (PubChem CID 116558152) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-(propan-2-ylamino)pentan-2-one.
| Compound Name | 1-(2-bromophenyl)-5-(propan-2-ylamino)pentan-2-one |
|---|---|
| PubChem CID | 116558152 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(2-bromophenyl)-5-(propan-2-ylamino)pentan-2-one |
| SMILES | CC(C)NCCCC(=O)Cc1ccccc1Br |
| InChI | InChI=1S/C14H20BrNO/c1-11(2)16-9-5-7-13(17)10-12-6-3-4-8-14(12)15/h3-4,6,8,11,16H,5,7,9-10H2,1-2H3 |
| InChIKey | YXGWKFGGEBPDNB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|