C13H19NO2 — CID 116567299
2-amino-1-(3,4-dimethylphenyl)-4-methoxybutan-1-one (PubChem CID 116567299) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-amino-1-(3,4-dimethylphenyl)-4-methoxybutan-1-one.
| Compound Name | 2-amino-1-(3,4-dimethylphenyl)-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 116567299 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-amino-1-(3,4-dimethylphenyl)-4-methoxybutan-1-one |
| SMILES | COCCC(N)C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-9-4-5-11(8-10(9)2)13(15)12(14)6-7-16-3/h4-5,8,12H,6-7,14H2,1-3H3 |
| InChIKey | BGGHXEAOXNIJGF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |