C15H22O3S — CID 64636268
1-(3,4-dimethylphenyl)-2-(3-methoxypropylsulfinyl)propan-1-one (PubChem CID 64636268) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(3-methoxypropylsulfinyl)propan-1-one.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(3-methoxypropylsulfinyl)propan-1-one |
|---|---|
| PubChem CID | 64636268 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(3-methoxypropylsulfinyl)propan-1-one |
| SMILES | COCCCS(=O)C(C)C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H22O3S/c1-11-6-7-14(10-12(11)2)15(16)13(3)19(17)9-5-8-18-4/h6-7,10,13H,5,8-9H2,1-4H3 |
| InChIKey | FFRCAZUORYCBFU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|