C16H24O2S — CID 107767829
1-(3,4-dimethylphenyl)-2-(2-methylbutylsulfinyl)propan-1-one (PubChem CID 107767829) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(2-methylbutylsulfinyl)propan-1-one.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(2-methylbutylsulfinyl)propan-1-one |
|---|---|
| PubChem CID | 107767829 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(2-methylbutylsulfinyl)propan-1-one |
| SMILES | CCC(C)CS(=O)C(C)C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H24O2S/c1-6-11(2)10-19(18)14(5)16(17)15-8-7-12(3)13(4)9-15/h7-9,11,14H,6,10H2,1-5H3 |
| InChIKey | HAINSMWMQGZEOL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |