C12H17N3O2 — CID 116570980
1-(4-amino-3-pyridinyl)-2-piperidin-4-yloxyethanone (PubChem CID 116570980) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(4-amino-3-pyridinyl)-2-piperidin-4-yloxyethanone.
| Compound Name | 1-(4-amino-3-pyridinyl)-2-piperidin-4-yloxyethanone |
|---|---|
| PubChem CID | 116570980 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-(4-amino-3-pyridinyl)-2-piperidin-4-yloxyethanone |
| SMILES | Nc1ccncc1C(=O)COC1CCNCC1 |
| InChI | InChI=1S/C12H17N3O2/c13-11-3-6-15-7-10(11)12(16)8-17-9-1-4-14-5-2-9/h3,6-7,9,14H,1-2,4-5,8H2,(H2,13,15) |
| InChIKey | WRKISCSJSWTLNN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |