C9H13N3O2 — CID 116590825
2-(2-aminoethoxy)-1-(4-amino-3-pyridinyl)ethanone (PubChem CID 116590825) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(4-amino-3-pyridinyl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(4-amino-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 116590825 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(4-amino-3-pyridinyl)ethanone |
| SMILES | NCCOCC(=O)c1cnccc1N |
| InChI | InChI=1S/C9H13N3O2/c10-2-4-14-6-9(13)7-5-12-3-1-8(7)11/h1,3,5H,2,4,6,10H2,(H2,11,12) |
| InChIKey | QRQPJVIYBOUUHW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|