C11H13F2NO2 — CID 107514948
2-(2-aminoethoxy)-1-(2,3-difluoro-4-methylphenyl)ethanone (PubChem CID 107514948) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(2,3-difluoro-4-methylphenyl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(2,3-difluoro-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 107514948 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(2,3-difluoro-4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)COCCN)c(F)c1F |
| InChI | InChI=1S/C11H13F2NO2/c1-7-2-3-8(11(13)10(7)12)9(15)6-16-5-4-14/h2-3H,4-6,14H2,1H3 |
| InChIKey | NWUSKUQEBGTYLT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|