C10H11Cl2NO2 — CID 116590901
2-(2-aminoethoxy)-1-(2,3-dichlorophenyl)ethanone (PubChem CID 116590901) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(2,3-dichlorophenyl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 116590901 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(2,3-dichlorophenyl)ethanone |
| SMILES | NCCOCC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c11-8-3-1-2-7(10(8)12)9(14)6-15-5-4-13/h1-3H,4-6,13H2 |
| InChIKey | KYDLFOURDVWGHH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|