C11H18ClN3O — CID 116571972
6-amino-1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-one (PubChem CID 116571972) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is 6-amino-1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-one.
| Compound Name | 6-amino-1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-one |
|---|---|
| PubChem CID | 116571972 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 6-amino-1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-one |
| SMILES | Cc1nn(C)c(Cl)c1CC(=O)CCCCN |
| InChI | InChI=1S/C11H18ClN3O/c1-8-10(11(12)15(2)14-8)7-9(16)5-3-4-6-13/h3-7,13H2,1-2H3 |
| InChIKey | XNNXRLLGCLDSDZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|